cas: 25877-46-7 — see every product listed under this CAS number, including other names
4-(5-Methyl-1,3,4-oxadiazol-2-yl)phenol 98% (CAS 25877-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A629866-100mg |
| cas | 25877-46-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 687.44 Pln | |
| Ambeed | 5g | 2550.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A629866 |
4-(5-methyl-1,3,4-oxadiazol-2-yl)phenol (CAS 25877-46-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 4-(5-methyl-1,3,4-oxadiazol-2-yl)phenol. InChIKey: ZGERZQXLBGWDCL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 4-(5-methyl-1,3,4-oxadiazol-2-yl)phenol |
| InChIKey | ZGERZQXLBGWDCL-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)