cas: 531508-46-0 — see every product listed under this CAS number, including other names
4-(Aminomethyl)-2,2-difluoro-1,3-benzodioxole 95% (CAS 531508-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A515083-100mg |
| cas | 531508-46-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 921.06 Pln | |
| Ambeed | 5g | 2962.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A515083 |
(2,2-difluoro-1,3-benzodioxol-4-yl)methanamine (CAS 531508-46-0) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: (2,2-difluoro-1,3-benzodioxol-4-yl)methanamine. InChIKey: LZUWIFLVQKZUOO-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | (2,2-difluoro-1,3-benzodioxol-4-yl)methanamine |
| InChIKey | LZUWIFLVQKZUOO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)CN |
Computed by PubChem (NCBI)