cas: 947279-22-3 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-1,2-difluorobenzene, 95+% (CAS 947279-22-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A532839-10g |
| cas | 947279-22-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8448.37 Pln | |
| AmBeed | 25g | 16572.85 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1,2-difluoro-4-phenylmethoxybenzene (CAS 947279-22-3) is a chemical compound with the molecular formula C13H10F2O and a molecular weight of 220.21 g/mol. IUPAC name: 1,2-difluoro-4-phenylmethoxybenzene. InChIKey: IKKBOMWNZYRNKN-UHFFFAOYSA-N.
| Molecular formula | C13H10F2O |
|---|---|
| Molecular weight | 220.21 g/mol |
| IUPAC name | 1,2-difluoro-4-phenylmethoxybenzene |
| InChIKey | IKKBOMWNZYRNKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)