4-(Dimethylamino)phenylboronic acid, 98%
cas: 28611-39-4 — see every product listed under this CAS number, including other names
4-(Dimethylamino)phenylboronic acid, 98% (CAS 28611-39-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A965786-250mg |
| cas | 28611-39-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 526.12 Pln | |
| Ambeed | 10g | 620.69 Pln | |
| Ambeed | 25g | 1165.81 Pln | |
| Ambeed | 100g | 4041.63 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 219.95 Pln | |
| BLDpharm | 5g | 558.72 Pln | |
| BLDpharm | 10g | 664.24 Pln | |
| BLDpharm | 25g | 1252.92 Pln | |
| BLDpharm | 100g | 4357.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[4-(dimethylamino)phenyl]boronic acid (CAS 28611-39-4) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 165.00 g/mol. IUPAC name: [4-(dimethylamino)phenyl]boronic acid. InChIKey: RIIPFHVHLXPMHQ-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 165.00 g/mol |
| IUPAC name | [4-(dimethylamino)phenyl]boronic acid |
| InChIKey | RIIPFHVHLXPMHQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Dimethylamino)phenylboronic acid, 4-(Dimethylamino)benzeneboronic acid, (4-(Dimethylamino)phenyl)boronic acid, 4-(N,N-Dimethylamino)phenylboronic acid, [4-(dimethylamino)phenyl]boronic acid, 4-Dimethylaminophenylboronic acid, 4-(Dimethylamino)phenylboronicacid, 4-(Dimethylamino)phenylboronic acid, >=95.0%, (4-dimethylaminophenyl)boronic Acid, 4-dimethylaminophenyl boronic acid