Products 2241875-87-4
CAS 2241875-87-4 is the registry number for (2–(propan–2–yl–d7)pyridin–4–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-pyridinyl]boronic acid (CAS 2241875-87-4) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 172.04 g/mol. IUPAC name: [2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-pyridinyl]boronic acid. InChIKey: DHMDAJOLNCYXNB-NWOXSKRJSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 172.04 g/mol |
| IUPAC name | [2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-4-pyridinyl]boronic acid |
| InChIKey | DHMDAJOLNCYXNB-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC=CC(=C1)B(O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)