cas: 890715-18-1 — see every product listed under this CAS number, including other names
4-(Furan-3-yl)benzoic acid, 98+% (CAS 890715-18-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A210229-1g |
| cas | 890715-18-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6625.57 Pln | |
| AmBeed | 10g | 25459.00 Pln | |
| AmBeed | 5g | 18180.82 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(furan-3-yl)benzoic acid (CAS 890715-18-1) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 4-(furan-3-yl)benzoic acid. InChIKey: AEVDLVIYBANTFB-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 4-(furan-3-yl)benzoic acid |
| InChIKey | AEVDLVIYBANTFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=COC=C2)C(=O)O |
Computed by PubChem (NCBI)