cas: 72693-60-8 — see every product listed under this CAS number, including other names
4-(Phenylamino)-1H-1,2,3-triazole-5-carboxylic acid, 97%, 97% (CAS 72693-60-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116Q5Y-50mg |
| cas | 72693-60-8 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 611.60 Pln | |
| Chemat | 100mg | 779.60 Pln | |
| Chemat | 250mg | 1139.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-anilino-2H-triazole-4-carboxylic acid (CAS 72693-60-8) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 5-anilino-2H-triazole-4-carboxylic acid. InChIKey: QLPAJQMELGXQCL-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 5-anilino-2H-triazole-4-carboxylic acid |
| InChIKey | QLPAJQMELGXQCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NNN=C2C(=O)O |
Computed by PubChem (NCBI)