cas: 57748-41-1 — see every product listed under this CAS number, including other names
4-(pyridin-2-ylmethoxy)benzaldehyde, 97% (CAS 57748-41-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 500mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F308306-1G |
| cas | 57748-41-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 500mg | 810.15 Pln | |
| Fluorochem | 5g | 3376.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(pyridin-2-ylmethoxy)benzaldehyde (CAS 57748-41-1) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 4-(pyridin-2-ylmethoxy)benzaldehyde. InChIKey: MKHNUKSZFMWQJL-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 4-(pyridin-2-ylmethoxy)benzaldehyde |
| InChIKey | MKHNUKSZFMWQJL-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)COC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)