cas: 1427082-83-4 — see every product listed under this CAS number, including other names
4-ACETYL-3-FLUOROBENZOIC ACID, 97% (CAS 1427082-83-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F854810-250MG |
| cas | 1427082-83-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 500mg | 544.62 Pln | |
| Fluorochem | 1g | 633.13 Pln | |
| Fluorochem | 5g | 2705.32 Pln | |
| Fluorochem | 10g | 4782.71 Pln | |
| Fluorochem | 25g | 9973.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-acetyl-3-fluorobenzoic acid (CAS 1427082-83-4) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 4-acetyl-3-fluorobenzoic acid. InChIKey: BPEHVKSKTXMKNX-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 4-acetyl-3-fluorobenzoic acid |
| InChIKey | BPEHVKSKTXMKNX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)