cas: 1427082-83-4 — see every product listed under this CAS number, including other names
4-Acetyl-3-fluorobenzoic acid, 95%, 95% (CAS 1427082-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DW29-100mg |
| cas | 1427082-83-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1941.20 Pln | |
| Chemat | 10g | 3597.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-acetyl-3-fluorobenzoic acid (CAS 1427082-83-4) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 4-acetyl-3-fluorobenzoic acid. InChIKey: BPEHVKSKTXMKNX-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 4-acetyl-3-fluorobenzoic acid |
| InChIKey | BPEHVKSKTXMKNX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)