4-Acetoxy-3-bromobenzoic acid, 95+%
cas: 72415-57-7 — see every product listed under this CAS number, including other names
4-Acetoxy-3-bromobenzoic acid, 95+% (CAS 72415-57-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A584510-100mg |
| cas | 72415-57-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1293.75 Pln | |
| Ambeed | 250mg | 2089.19 Pln | |
| Ambeed | 1g | 5754.88 Pln | |
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 582.80 Pln | |
| Chemat | 1g | 1101.20 Pln | |
| BLDpharm | 100mg | 1386.20 Pln | |
| BLDpharm | 250mg | 2247.01 Pln | |
| BLDpharm | 1g | 6195.62 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
4-acetyloxy-3-bromobenzoic acid (CAS 72415-57-7) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 4-acetyloxy-3-bromobenzoic acid. InChIKey: RGQHBWNTRVUICJ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 4-acetyloxy-3-bromobenzoic acid |
| InChIKey | RGQHBWNTRVUICJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)