cas: 944-43-4 — see every product listed under this CAS number, including other names
4-Amino-2,3,5,6-tetrafluorobenzoic acid, 97%, 97% (CAS 944-43-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KO2-250mg |
| cas | 944-43-4 |
| size | 250mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 587.60 Pln | |
| Chemat | 10g | 1091.60 Pln | |
| Chemat | 25g | 2301.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-amino-2,3,5,6-tetrafluorobenzoic acid (CAS 944-43-4) is a chemical compound with the molecular formula C7H3F4NO2 and a molecular weight of 209.10 g/mol. IUPAC name: 4-amino-2,3,5,6-tetrafluorobenzoic acid. InChIKey: WTNSXWSOTDBWOR-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO2 |
|---|---|
| Molecular weight | 209.10 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetrafluorobenzoic acid |
| InChIKey | WTNSXWSOTDBWOR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)C(=O)O |
Computed by PubChem (NCBI)