CAS 4123-72-2 appears in our catalog under these names: 4–Amino–3,5–dibromobenzoic acid, 4-Amino-3,5-dibromobenzoic acid, Benzoic acid, 4-amino-3,5-dibromo-, 97%, 97%, 4-Amino-3,5-dibromobenzoic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 50g, 100g, 250mg, 1g.
4-amino-3,5-dibromobenzoic acid (CAS 4123-72-2) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 4-amino-3,5-dibromobenzoic acid. InChIKey: VWYQFZKTKAMCLU-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 4-amino-3,5-dibromobenzoic acid |
| InChIKey | VWYQFZKTKAMCLU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C(=O)O |
Computed by PubChem (NCBI)