CAS 21386-43-6 appears in our catalog under these names: 3,5-Dibromosalicylaldoxime, 95%, 3,5–Dibromosalicylaldoxime, 3,5-Dibromosalicylaldoxime, >98.0%(GC), 3,5-Dibromo-2-hydroxybenzaldehyde oxime, ≥98%(GC), ≥98%(GC). Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 10g, 5g.
2,4-dibromo-6-(hydroxyiminomethyl)phenol (CAS 21386-43-6) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 2,4-dibromo-6-(hydroxyiminomethyl)phenol. InChIKey: LRNICNSWROUZCF-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 2,4-dibromo-6-(hydroxyiminomethyl)phenol |
| InChIKey | LRNICNSWROUZCF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=NO)O)Br)Br |
Computed by PubChem (NCBI)