CAS 73557-63-8 appears in our catalog under these names: 1,2-Dibromo-5-methyl-3-nitrobenzene, 95%, 1,2-Dibromo-5-methyl-3-nitrobenzene, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
1,2-dibromo-5-methyl-3-nitrobenzene (CAS 73557-63-8) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: 1,2-dibromo-5-methyl-3-nitrobenzene. InChIKey: XTMGEWKAQQAYST-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | 1,2-dibromo-5-methyl-3-nitrobenzene |
| InChIKey | XTMGEWKAQQAYST-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)