cas: 71675-87-1 — see every product listed under this CAS number, including other names
4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic Acid, >98.0%(HPLC)(T) (CAS 71675-87-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2615-1G |
| cas | 71675-87-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 108.51 Pln | |
| TCI | 5g | 324.87 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
4-amino-5-ethylsulfonyl-2-methoxybenzoic acid (CAS 71675-87-1) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid. InChIKey: OJVNCXHGGYYOPH-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid |
| InChIKey | OJVNCXHGGYYOPH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)OC)N |
Computed by PubChem (NCBI)