cas: 71675-87-1 — see every product listed under this CAS number, including other names
4-Amino-5-(ethylsulfonyl)-2-methoxybenzoic acid, 98%, 98% (CAS 71675-87-1) is a chemical reagent available from Chemat. Available pack sizes: 50g, 75g, 200g, 300g, 1g, 5g, 10g, 15g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IC7Q-50g |
| cas | 71675-87-1 |
| size | 50g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 266.00 Pln | |
| Chemat | 75g | 366.80 Pln | |
| Chemat | 200g | 803.60 Pln | |
| Chemat | 300g | 1158.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 15g | 136.40 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 453.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-amino-5-ethylsulfonyl-2-methoxybenzoic acid (CAS 71675-87-1) is a chemical compound with the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. IUPAC name: 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid. InChIKey: OJVNCXHGGYYOPH-UHFFFAOYSA-N.
| Molecular formula | C10H13NO5S |
|---|---|
| Molecular weight | 259.28 g/mol |
| IUPAC name | 4-amino-5-ethylsulfonyl-2-methoxybenzoic acid |
| InChIKey | OJVNCXHGGYYOPH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(C=C(C(=C1)C(=O)O)OC)N |
Computed by PubChem (NCBI)