cas: 33890-03-8 — see every product listed under this CAS number, including other names
4-Aminoisophthalic acid 98% (CAS 33890-03-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A177527-10g |
| cas | 33890-03-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 1699.81 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1087.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A177527 |
4-aminobenzene-1,3-dicarboxylic acid (CAS 33890-03-8) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 4-aminobenzene-1,3-dicarboxylic acid. InChIKey: BDBLLWHZWCBDAR-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 4-aminobenzene-1,3-dicarboxylic acid |
| InChIKey | BDBLLWHZWCBDAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)N |
Computed by PubChem (NCBI)