cas: 953421-74-4 — see every product listed under this CAS number, including other names
4-BROMO-1,7-DICHLOROISOQUINOLINE, 97% (CAS 953421-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F535260-100MG |
| cas | 953421-74-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 914.28 Pln | |
| Fluorochem | 250mg | 1596.33 Pln | |
| Fluorochem | 1g | 4782.71 Pln | |
| Fluorochem | 5g | 21063.43 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-1,7-dichloroisoquinoline (CAS 953421-74-4) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 4-bromo-1,7-dichloroisoquinoline. InChIKey: MPNVIJOSWLWNKA-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 4-bromo-1,7-dichloroisoquinoline |
| InChIKey | MPNVIJOSWLWNKA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=NC=C2Br)Cl |
Computed by PubChem (NCBI)