cas: 150019-57-1 — see every product listed under this CAS number, including other names
4-Benzo[1,3]dioxol-5-yl-4-hydroxycyclohexanone, 95%+, 95%+ (CAS 150019-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112M0D-100mg |
| cas | 150019-57-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3506.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-(1,3-benzodioxol-5-yl)-4-hydroxycyclohexan-1-one (CAS 150019-57-1) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 4-(1,3-benzodioxol-5-yl)-4-hydroxycyclohexan-1-one. InChIKey: ISBCBGZLNXQEEF-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 4-(1,3-benzodioxol-5-yl)-4-hydroxycyclohexan-1-one |
| InChIKey | ISBCBGZLNXQEEF-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C2=CC3=C(C=C2)OCO3)O |
Computed by PubChem (NCBI)