cas: 151982-51-3 — see every product listed under this CAS number, including other names
4-Bromo-2-Fluorobenzoyl Chloride, 98%, 98% (CAS 151982-51-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KWR-1g |
| cas | 151982-51-3 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 150.80 Pln | |
| Chemat | 25g | 434.00 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 100g | 1547.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-fluorobenzoyl chloride (CAS 151982-51-3) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-fluorobenzoyl chloride. InChIKey: PCFIABOQFAFDAU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-fluorobenzoyl chloride |
| InChIKey | PCFIABOQFAFDAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)Cl |
Computed by PubChem (NCBI)