cas: 151982-51-3 — see every product listed under this CAS number, including other names
4-Bromo-2-fluorobenzoyl chloride, 99% (CAS 151982-51-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 347460050 |
| cas | 151982-51-3 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 195.55 Pln | |
| Thermo Scientific (Acros) | 25g | 654.80 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
4-bromo-2-fluorobenzoyl chloride (CAS 151982-51-3) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-fluorobenzoyl chloride. InChIKey: PCFIABOQFAFDAU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-fluorobenzoyl chloride |
| InChIKey | PCFIABOQFAFDAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)Cl |
Computed by PubChem (NCBI)