cas: 151982-51-3 — see every product listed under this CAS number, including other names
4–Bromo–2–fluorobenzoyl chloride (CAS 151982-51-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD02962-1g |
| cas | 151982-51-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 522.15 Pln | |
| GLPBio | 25g | 1542.50 Pln | |
| GLPBio | 5g | 737.45 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-2-fluorobenzoyl chloride (CAS 151982-51-3) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 4-bromo-2-fluorobenzoyl chloride. InChIKey: PCFIABOQFAFDAU-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 4-bromo-2-fluorobenzoyl chloride |
| InChIKey | PCFIABOQFAFDAU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)Cl |
Computed by PubChem (NCBI)