cas: 99277-71-1 — see every product listed under this CAS number, including other names
4-Bromo-2-nitrobenzoic acid, 97%, 97% (CAS 99277-71-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KXF-5g |
| cas | 99277-71-1 |
| size | 5g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 501.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-nitrobenzoic acid (CAS 99277-71-1) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 4-bromo-2-nitrobenzoic acid. InChIKey: ZIRHHEZLJGORGU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 4-bromo-2-nitrobenzoic acid |
| InChIKey | ZIRHHEZLJGORGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)