cas: 99277-71-1 — see every product listed under this CAS number, including other names
4-Bromo-2-nitrobenzoic acid, 99.77% (CAS 99277-71-1) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W002727-10 g |
| cas | 99277-71-1 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 240.74 Pln | |
| MedChemExpress | 25 g | 310.40 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.77% |
4-bromo-2-nitrobenzoic acid (CAS 99277-71-1) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 4-bromo-2-nitrobenzoic acid. InChIKey: ZIRHHEZLJGORGU-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 4-bromo-2-nitrobenzoic acid |
| InChIKey | ZIRHHEZLJGORGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)