cas: 1003048-72-3 — see every product listed under this CAS number, including other names
4-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-one, 98%, 98% (CAS 1003048-72-3) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112K5-1kg |
| cas | 1003048-72-3 |
| size | 1kg |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 4235.60 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 251.60 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 50g | 784.40 Pln | |
| Chemat | 100g | 1235.60 Pln | |
| Chemat | 250g | 2747.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-7-fluoro-2,3-dihydroinden-1-one (CAS 1003048-72-3) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 4-bromo-7-fluoro-2,3-dihydroinden-1-one. InChIKey: HNXHWYGTXAJDEC-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 4-bromo-7-fluoro-2,3-dihydroinden-1-one |
| InChIKey | HNXHWYGTXAJDEC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C=CC(=C21)Br)F |
Computed by PubChem (NCBI)