CAS 174603-56-6 appears in our catalog under these names: 4-Bromo-6-fluoroindan-1-one, 97%, 4–Bromo–6–fluoro–2,3–dihydro–1H–inden–1–one, 4-Bromo-6-fluoro-2,3-dihydro-1H-inden-1-one 95%, 4-Bromo-6-fluoro-2,3-dihydro-1H-inden-1-one, 95%, 95%. Offered by: Fluorochem, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 250mg, 50g.
4-bromo-6-fluoro-2,3-dihydroinden-1-one (CAS 174603-56-6) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 4-bromo-6-fluoro-2,3-dihydroinden-1-one. InChIKey: KBBCLUTZUIWTON-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 4-bromo-6-fluoro-2,3-dihydroinden-1-one |
| InChIKey | KBBCLUTZUIWTON-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)F)Br |
Computed by PubChem (NCBI)