CAS 935681-01-9 appears in our catalog under these names: 4-Bromo-5-fluoro-2,3-dihydro-1h-inden-1-one, 95%, 4–Bromo–5–fluoro–2,3–dihydro–1H–inden–1–one, 4-Bromo-5-fluoro-2,3-dihydro-1H-inden-1-one, 4-Bromo-5-fluoro-2,3-dihydro-1H-inden-1-one 95%, 4-BROMO-5-FLUORO-2,3-DIHYDRO-1H-INDEN-1-ONE, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g.
4-bromo-5-fluoro-2,3-dihydroinden-1-one (CAS 935681-01-9) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 4-bromo-5-fluoro-2,3-dihydroinden-1-one. InChIKey: JTVKCVNXTBXSOL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2,3-dihydroinden-1-one |
| InChIKey | JTVKCVNXTBXSOL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=C(C=C2)F)Br |
Computed by PubChem (NCBI)