CAS 1260012-83-6 appears in our catalog under these names: 6–Bromo–7–fluoro–2,3–dihydro–1H–inden–1–one, 6-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-one 95%, 6-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-one, 95%, 95%, 6-BROMO-7-FLUORO-2,3-DIHYDRO-1H-INDEN-1-ONE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-7-fluoro-2,3-dihydroinden-1-one (CAS 1260012-83-6) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 6-bromo-7-fluoro-2,3-dihydroinden-1-one. InChIKey: BIMMJVIETAHQMW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 6-bromo-7-fluoro-2,3-dihydroinden-1-one |
| InChIKey | BIMMJVIETAHQMW-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2F)Br |
Computed by PubChem (NCBI)