CAS 881189-74-8 appears in our catalog under these names: 6–Bromo–4–fluoro–2,3–dihydro–1H–inden–1–one, 6-Bromo-4-fluoro-1-indanone, 6-Bromo-4-fluoro-2,3-dihydro-1H-inden-1-one 95%, 6-Bromo-4-fluoro-2,3-dihydro-1H-inden-1-one, 95%, 95%, 6-Bromo-4-fluoro-2,3-dihydro-1H-inden-1-one, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 100mg, 5g, 25g, 100g.
6-bromo-4-fluoro-2,3-dihydroinden-1-one (CAS 881189-74-8) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 6-bromo-4-fluoro-2,3-dihydroinden-1-one. InChIKey: FVPXVDTWEBFLLE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 6-bromo-4-fluoro-2,3-dihydroinden-1-one |
| InChIKey | FVPXVDTWEBFLLE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC(=C2)Br)F |
Computed by PubChem (NCBI)