CAS 1260011-83-3 appears in our catalog under these names: 7–Bromo–6–fluoro–2,3–dihydro–1H–inden–1–one, 7-Bromo-6-fluoro-2,3-dihydro-1H-inden-1-one 95%, 7-Bromo-6-fluoro-2,3-dihydro-1H-inden-1-one, 95%, 95%, 7-Bromo-6-fluoro-2,3-dihydro-1H-inden-1-one, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
7-bromo-6-fluoro-2,3-dihydroinden-1-one (CAS 1260011-83-3) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 7-bromo-6-fluoro-2,3-dihydroinden-1-one. InChIKey: PVWJFHDXZQXBRZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 7-bromo-6-fluoro-2,3-dihydroinden-1-one |
| InChIKey | PVWJFHDXZQXBRZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2Br)F |
Computed by PubChem (NCBI)