Products 1242157-14-7
CAS 1242157-14-7 appears in our catalog under these names: 5–Bromo–7–fluoro–1–indanone, 5-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-one, 95%, 5-Bromo-7-fluoro-2,3-dihydro-1H-inden-1-one, 98%. Offered by: GLPBio, Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g, 100g, 50g.
5-bromo-7-fluoro-2,3-dihydroinden-1-one (CAS 1242157-14-7) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 5-bromo-7-fluoro-2,3-dihydroinden-1-one. InChIKey: VMPKZIKGIGAVGK-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 5-bromo-7-fluoro-2,3-dihydroinden-1-one |
| InChIKey | VMPKZIKGIGAVGK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2F)Br |
Computed by PubChem (NCBI)