CAS 866862-25-1 appears in our catalog under these names: 1H-Inden-1-one, 5-bromo-6-fluoro-2,3-dihydro-, 95%, 5-Bromo-6-fluoro-2,3-dihydro-1H-inden-1-one 95%, 5-Bromo-6-fluoro-2,3-dihydro-1H-inden-1-one, 98%, 98%, 5-Bromo-6-fluoro-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g, 500mg.
5-bromo-6-fluoro-2,3-dihydroinden-1-one (CAS 866862-25-1) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 5-bromo-6-fluoro-2,3-dihydroinden-1-one. InChIKey: NPJWOVWPFKCPHM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2,3-dihydroinden-1-one |
| InChIKey | NPJWOVWPFKCPHM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)Br)F |
Computed by PubChem (NCBI)