cas: 286932-78-3 — see every product listed under this CAS number, including other names
4-Chloro-2,5-difluorobenzenesulfonylchloride, 95% (CAS 286932-78-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A259838-250mg |
| cas | 286932-78-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 782.00 Pln | |
| Ambeed | 25g | 2634.31 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 303.25 Pln | |
| BLDpharm | 5g | 841.95 Pln | |
| BLDpharm | 25g | 2835.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-chloro-2,5-difluorobenzenesulfonyl chloride (CAS 286932-78-3) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 4-chloro-2,5-difluorobenzenesulfonyl chloride. InChIKey: RONRQDJNXCXAOU-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F2O2S |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 4-chloro-2,5-difluorobenzenesulfonyl chloride |
| InChIKey | RONRQDJNXCXAOU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)F)Cl)F |
Computed by PubChem (NCBI)