cas: 87602-66-2 — see every product listed under this CAS number, including other names
4-Chloro-2,6,8-Trimethylquinoline, 97%, 97% (CAS 87602-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GRCB-100mg |
| cas | 87602-66-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 726.80 Pln | |
| Chemat | 5g | 3251.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-chloro-2,6,8-trimethylquinoline (CAS 87602-66-2) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 4-chloro-2,6,8-trimethylquinoline. InChIKey: FGGSFRDVXDCVEI-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 4-chloro-2,6,8-trimethylquinoline |
| InChIKey | FGGSFRDVXDCVEI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C)Cl)C |
Computed by PubChem (NCBI)