cas: 87602-66-2 — see every product listed under this CAS number, including other names
4-Chloro-2,6,8-trimethylquinoline, 97% (CAS 87602-66-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F720883-250MG |
| cas | 87602-66-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 1174.60 Pln | |
| Fluorochem | 5g | 5355.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-chloro-2,6,8-trimethylquinoline (CAS 87602-66-2) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 4-chloro-2,6,8-trimethylquinoline. InChIKey: FGGSFRDVXDCVEI-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 4-chloro-2,6,8-trimethylquinoline |
| InChIKey | FGGSFRDVXDCVEI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C)Cl)C |
Computed by PubChem (NCBI)