4-Chloro-2-ethylthieno[2,3-d]pyrimidine, 98%
cas: 56844-11-2 — see every product listed under this CAS number, including other names
4-Chloro-2-ethylthieno[2,3-d]pyrimidine, 98% (CAS 56844-11-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A278772-250mg |
| cas | 56844-11-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 871.00 Pln | |
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 803.60 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 930.81 Pln | |
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 1486.99 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-2-ethylthieno[2,3-d]pyrimidine (CAS 56844-11-2) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 4-chloro-2-ethylthieno[2,3-d]pyrimidine. InChIKey: PKCDEKLEICRQKQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 4-chloro-2-ethylthieno[2,3-d]pyrimidine |
| InChIKey | PKCDEKLEICRQKQ-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C=CS2)C(=N1)Cl |
Computed by PubChem (NCBI)