Products 56844-11-2
CAS 56844-11-2 appears in our catalog under these names: 4-Chloro-2-ethylthieno[2,3-d]pyrimidine, 98%, 4-Chloro-2-ethylthieno[2,3-d]pyrimidine, 98%, 98%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-2-ethylthieno[2,3-d]pyrimidine (CAS 56844-11-2) is a chemical compound with the molecular formula C8H7ClN2S and a molecular weight of 198.67 g/mol. IUPAC name: 4-chloro-2-ethylthieno[2,3-d]pyrimidine. InChIKey: PKCDEKLEICRQKQ-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2S |
|---|---|
| Molecular weight | 198.67 g/mol |
| IUPAC name | 4-chloro-2-ethylthieno[2,3-d]pyrimidine |
| InChIKey | PKCDEKLEICRQKQ-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C=CS2)C(=N1)Cl |
Computed by PubChem (NCBI)