4-Chloro-2-fluoro-3-methoxyphenylboronic acid, 98%, 98%
cas: 944129-07-1 — see every product listed under this CAS number, including other names
4-Chloro-2-fluoro-3-methoxyphenylboronic acid, 98%, 98% (CAS 944129-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11478R-100mg |
| cas | 944129-07-1 |
| size | 100mg |
| availability | 714.75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 198.80 Pln | |
| Chemat | 10g | 304.40 Pln | |
| Chemat | 25g | 510.80 Pln | |
| Chemat | 50g | 750.80 Pln | |
| Chemat | 100g | 1163.60 Pln | |
| Chemat | 250g | 2474.00 Pln | |
| Chemat | 500g | 4267.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-chloro-2-fluoro-3-methoxyphenyl)boronic acid (CAS 944129-07-1) is a chemical compound with the molecular formula C7H7BClFO3 and a molecular weight of 204.39 g/mol. IUPAC name: (4-chloro-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: GDJCQSNQOHRAGY-UHFFFAOYSA-N.
| Molecular formula | C7H7BClFO3 |
|---|---|
| Molecular weight | 204.39 g/mol |
| IUPAC name | (4-chloro-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | GDJCQSNQOHRAGY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Cl)OC)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-Chloro-2-fluoro-3-methoxyphenyl)boronic acid, 4-Chloro-2-fluoro-3-methoxyphenyl boronic acid, (4-Chloro-2-fluoro-3-methoxyphenyl)boronicacid, (4-chloro-2-fluoro-3-methoxy-phenyl)boronic acid, (4-chloro-2-fluoro-3-methoxyphenyl)-boronic acid, GDJCQSNQOHRAGY-UHFFFAOYSA-N, (4-chloro-2-fluoro-3-methoxyphenyl)-boroni