4-Chloro-3,5-difluorobenzenesulfonyl chloride, 95%
cas: 1706435-19-9 — see every product listed under this CAS number, including other names
4-Chloro-3,5-difluorobenzenesulfonyl chloride, 95% (CAS 1706435-19-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1048196-100mg |
| cas | 1706435-19-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 770.88 Pln | |
| Ambeed | 1g | 1872.25 Pln | |
| Ambeed | 5g | 5799.38 Pln | |
| BLDpharm | 100mg | 486.52 Pln | |
| BLDpharm | 250mg | 825.29 Pln | |
| BLDpharm | 1g | 2013.76 Pln | |
| BLDpharm | 5g | 6251.16 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-chloro-3,5-difluorobenzenesulfonyl chloride (CAS 1706435-19-9) is a chemical compound with the molecular formula C6H2Cl2F2O2S and a molecular weight of 247.05 g/mol. IUPAC name: 4-chloro-3,5-difluorobenzenesulfonyl chloride. InChIKey: KAHGIUIIJGMIDP-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2F2O2S |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 4-chloro-3,5-difluorobenzenesulfonyl chloride |
| InChIKey | KAHGIUIIJGMIDP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)