Products 17970-75-1
CAS 17970-75-1 appears in our catalog under these names: 2-Chloro-6-nitrobenzene-1-sulfonyl chloride, 2-Chloro-6-nitrobenzene-1-sulfonyl chloride 95+%, 2-Chloro-6-nitrobenzene-1-sulfonyl chloride, 95+%, 95+%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g.
2-chloro-6-nitrobenzenesulfonyl chloride (CAS 17970-75-1) is a chemical compound with the molecular formula C6H3Cl2NO4S and a molecular weight of 256.06 g/mol. IUPAC name: 2-chloro-6-nitrobenzenesulfonyl chloride. InChIKey: BSTJKQQPWQCPLP-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO4S |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | 2-chloro-6-nitrobenzenesulfonyl chloride |
| InChIKey | BSTJKQQPWQCPLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)