cas: 214470-55-0 — see every product listed under this CAS number, including other names
4-Chloro-6,7-dimethoxyquinoline-3-carbonitrile 97% (CAS 214470-55-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A885068-100mg |
| cas | 214470-55-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 492.75 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1616.38 Pln | |
| Ambeed | 5g | 5204.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A885068 |
4-chloro-6,7-dimethoxyquinoline-3-carbonitrile (CAS 214470-55-0) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 4-chloro-6,7-dimethoxyquinoline-3-carbonitrile. InChIKey: HMLOMVBFQJAMCN-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 4-chloro-6,7-dimethoxyquinoline-3-carbonitrile |
| InChIKey | HMLOMVBFQJAMCN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(C=N2)C#N)Cl)OC |
Computed by PubChem (NCBI)