cas: 147065-05-2 — see every product listed under this CAS number, including other names
4-Chloro-D-phenylalanine Hydrochloride, 98.0%, 98.0% (CAS 147065-05-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112EKU-1g |
| cas | 147065-05-2 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 222.80 Pln |
| purity | 98.0% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride (CAS 147065-05-2) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (2R)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride. InChIKey: PFOCEDBJFKVRHU-DDWIOCJRSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | PFOCEDBJFKVRHU-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)