cas: 147065-05-2 — see every product listed under this CAS number, including other names
4-Chloro-D-phenylalanine hydrochloride (CAS 147065-05-2) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03166-200MG |
| cas | 147065-05-2 |
| size | 200mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 200mg | 529.00 Pln | |
| Fluorochem | 1g | 1252.70 Pln | |
| Fluorochem | 5g | 4173.55 Pln | |
| Fluorochem | 10g | 7474.47 Pln |
| delivery time | 2-3 weeks |
|---|
(2R)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride (CAS 147065-05-2) is a chemical compound with the molecular formula C9H11Cl2NO2 and a molecular weight of 236.09 g/mol. IUPAC name: (2R)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride. InChIKey: PFOCEDBJFKVRHU-DDWIOCJRSA-N.
| Molecular formula | C9H11Cl2NO2 |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride |
| InChIKey | PFOCEDBJFKVRHU-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)