cas: 1247927-81-6 — see every product listed under this CAS number, including other names
4-Cyclopropyl-2-fluorobenzoic acid 98% (CAS 1247927-81-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A621236-100mg |
| cas | 1247927-81-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 826.50 Pln | |
| Ambeed | 1g | 2361.75 Pln | |
| Ambeed | 5g | 6956.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A621236 |
4-cyclopropyl-2-fluorobenzoic acid (CAS 1247927-81-6) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 4-cyclopropyl-2-fluorobenzoic acid. InChIKey: UPYZCTDSUYXKBG-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 4-cyclopropyl-2-fluorobenzoic acid |
| InChIKey | UPYZCTDSUYXKBG-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)