Products 850568-08-0
CAS 850568-08-0 appears in our catalog under these names: 4–Ethoxy–3–methylbenzeneboronic acid, (4-Ethoxy-3-methylphenyl)boronic Acid (contains varying amounts of Anhydride), 4-Ethoxy-3-methylphenylboronic acid, 98%, 98%, 4-Ethoxy-3-methylphenylboronic acid, 98%, 4-Ethoxy-3-methylphenylboronic acid, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
4-Ethoxy-3-methylphenylboronic acid, 98%, 98%
Chemat- size: 250mg, 1g, 5g, 25g
- Variants: 4
from 83.60
(4-ethoxy-3-methylphenyl)boronic acid (CAS 850568-08-0) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-ethoxy-3-methylphenyl)boronic acid. InChIKey: GAFSYSHEDOIUSI-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-ethoxy-3-methylphenyl)boronic acid |
| InChIKey | GAFSYSHEDOIUSI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC)C)(O)O |
Computed by PubChem (NCBI)