Products 246023-54-1

CAS 246023-54-1 appears in our catalog under these names: 4-Methoxy-2,5-dimethylphenylboronic acid, 96%, 4–Methoxy–2,5–dimethylphenylboronic Acid, 4-Methoxy-2,5-dimethylphenylboronic Acid (contains varying amounts of Anhydride), 2,5-Dimethyl-4-methoxyphenylboronic acid 97%, 2,5-Dimethyl-4-methoxyphenylboronic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(4-methoxy-2,5-dimethylphenyl)boronic acid (CAS 246023-54-1) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-methoxy-2,5-dimethylphenyl)boronic acid. InChIKey: IUUWNGBWUJVQCF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BO3
Molecular weight180.01 g/mol
IUPAC name(4-methoxy-2,5-dimethylphenyl)boronic acid
InChIKeyIUUWNGBWUJVQCF-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1C)OC)C)(O)O

Computed by PubChem (NCBI)