Products 847345-37-3
CAS 847345-37-3 appears in our catalog under these names: 5-Ethyl-2-methoxyphenylboronic acid, 98%, (5-Ethyl-2-methoxyphenyl)boronic acid, 98%, 5-Ethyl-2-methoxyphenylboronic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 50mg, 0,5g.
(5-ethyl-2-methoxyphenyl)boronic acid (CAS 847345-37-3) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (5-ethyl-2-methoxyphenyl)boronic acid. InChIKey: RJACNUQXPIDDEV-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (5-ethyl-2-methoxyphenyl)boronic acid |
| InChIKey | RJACNUQXPIDDEV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CC)OC)(O)O |
Computed by PubChem (NCBI)