CAS 1451391-98-2 appears in our catalog under these names: (2-Methoxy-3,5-dimethylphenyl)boronic acid, 98%, 3,5-Dimethyl-2-methoxyphenylboronic acid, 95%, 3,5-Dimethyl-2-methoxyphenylboronic acid, ≥95%, (2-Methoxy-3,5-dimethylphenyl)boronic acid, ≥99.5%, ≥99.5%. Offered by: AmBeed, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
(2-methoxy-3,5-dimethylphenyl)boronic acid (CAS 1451391-98-2) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (2-methoxy-3,5-dimethylphenyl)boronic acid. InChIKey: UHTQRLCDAMYQFY-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (2-methoxy-3,5-dimethylphenyl)boronic acid |
| InChIKey | UHTQRLCDAMYQFY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)C)C)(O)O |
Computed by PubChem (NCBI)