Products 1256346-05-0
CAS 1256346-05-0 appears in our catalog under these names: 3-Ethoxy-5-methylphenylboronic acid, 98%, 3-Ethoxy-5-methylphenylboronic acid, >95% (HPLC), (3-Ethoxy-5-methylphenyl)boronic acid 98%, 3-Ethoxy-5-methylphenylboronic acid, 98%, 98%, (3-Ethoxy-5-methylphenyl)boronic acid. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100mg, 500mg, 10g, 250mg.
(3-ethoxy-5-methylphenyl)boronic acid (CAS 1256346-05-0) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (3-ethoxy-5-methylphenyl)boronic acid. InChIKey: DYSSQITZDLDPSX-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (3-ethoxy-5-methylphenyl)boronic acid |
| InChIKey | DYSSQITZDLDPSX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OCC)C)(O)O |
Computed by PubChem (NCBI)